C20H22Cl2N2O2 — CID 6902506
(E)-1-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-piperidin-1-ylmethanimine (PubChem CID 6902506) has the molecular formula C20H22Cl2N2O2 and a molecular weight of 393.31 g/mol. Its IUPAC name is (E)-1-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-piperidin-1-ylmethanimine.
| Compound Name | (E)-1-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-piperidin-1-ylmethanimine |
|---|---|
| PubChem CID | 6902506 |
| Molecular Formula | C20H22Cl2N2O2 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | (E)-1-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-piperidin-1-ylmethanimine |
| SMILES | COc1cc(/C=N/N2CCCCC2)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H22Cl2N2O2/c1-25-20-11-15(13-23-24-9-3-2-4-10-24)5-8-19(20)26-14-16-6-7-17(21)12-18(16)22/h5-8,11-13H,2-4,9-10,14H2,1H3/b23-13+ |
| InChIKey | MPOJLNABINCJIM-YDZHTSKRSA-N |
| XLogP | 5.40 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|