C19H23N3O2S — CID 168611723
benzyl N'-[(3-methoxy-4-propoxyphenyl)methylideneamino]carbamimidothioate (PubChem CID 168611723) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is benzyl N'-[(3-methoxy-4-propoxyphenyl)methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[(3-methoxy-4-propoxyphenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168611723 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | benzyl N'-[(3-methoxy-4-propoxyphenyl)methylideneamino]carbamimidothioate |
| SMILES | CCCOc1ccc(C=NN=C(N)SCc2ccccc2)cc1OC |
| InChI | InChI=1S/C19H23N3O2S/c1-3-11-24-17-10-9-16(12-18(17)23-2)13-21-22-19(20)25-14-15-7-5-4-6-8-15/h4-10,12-13H,3,11,14H2,1-2H3,(H2,20,22) |
| InChIKey | YAYOUFDIQUWWKE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|