C19H17F6N3O2S — CID 168612799
benzyl N'-[[4-(1,1,2,3,3,3-hexafluoropropoxy)-3-methoxyphenyl]methylideneamino]carbamimidothioate (PubChem CID 168612799) has the molecular formula C19H17F6N3O2S and a molecular weight of 465.42 g/mol. Its IUPAC name is benzyl N'-[[4-(1,1,2,3,3,3-hexafluoropropoxy)-3-methoxyphenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[4-(1,1,2,3,3,3-hexafluoropropoxy)-3-methoxyphenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612799 |
| Molecular Formula | C19H17F6N3O2S |
| Molecular Weight | 465.42 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | benzyl N'-[[4-(1,1,2,3,3,3-hexafluoropropoxy)-3-methoxyphenyl]methylideneamino]carbamimidothioate |
| SMILES | COc1cc(C=NN=C(N)SCc2ccccc2)ccc1OC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C19H17F6N3O2S/c1-29-15-9-13(7-8-14(15)30-19(24,25)16(20)18(21,22)23)10-27-28-17(26)31-11-12-5-3-2-4-6-12/h2-10,16H,11H2,1H3,(H2,26,28) |
| InChIKey | HNPQSRFEPLQXPY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.42 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|