C25H26N4O4S — CID 168611956
benzyl N'-[[3-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]carbamimidothioate (PubChem CID 168611956) has the molecular formula C25H26N4O4S and a molecular weight of 478.57 g/mol. Its IUPAC name is benzyl N'-[[3-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[3-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168611956 |
| Molecular Formula | C25H26N4O4S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | benzyl N'-[[3-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]carbamimidothioate |
| SMILES | COc1ccc(NC(=O)COc2ccc(C=NN=C(N)SCc3ccccc3)cc2OC)cc1 |
| InChI | InChI=1S/C25H26N4O4S/c1-31-21-11-9-20(10-12-21)28-24(30)16-33-22-13-8-19(14-23(22)32-2)15-27-29-25(26)34-17-18-6-4-3-5-7-18/h3-15H,16-17H2,1-2H3,(H2,26,29)(H,28,30) |
| InChIKey | UWNJENZTMBUPAG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|