C27H30N4O4S — CID 168613084
benzyl N'-[[3-ethoxy-4-[2-(4-ethoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]carbamimidothioate (PubChem CID 168613084) has the molecular formula C27H30N4O4S and a molecular weight of 506.63 g/mol. Its IUPAC name is benzyl N'-[[3-ethoxy-4-[2-(4-ethoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[3-ethoxy-4-[2-(4-ethoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168613084 |
| Molecular Formula | C27H30N4O4S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | benzyl N'-[[3-ethoxy-4-[2-(4-ethoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]carbamimidothioate |
| SMILES | CCOc1ccc(NC(=O)COc2ccc(C=NN=C(N)SCc3ccccc3)cc2OCC)cc1 |
| InChI | InChI=1S/C27H30N4O4S/c1-3-33-23-13-11-22(12-14-23)30-26(32)18-35-24-15-10-21(16-25(24)34-4-2)17-29-31-27(28)36-19-20-8-6-5-7-9-20/h5-17H,3-4,18-19H2,1-2H3,(H2,28,31)(H,30,32) |
| InChIKey | VNIPZAOYTRFZQW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|