C10H12N2O2S2 — CID 163408586
methyl N-[(4-hydroxy-3-methoxyphenyl)methylideneamino]carbamodithioate (PubChem CID 163408586) has the molecular formula C10H12N2O2S2 and a molecular weight of 256.35 g/mol. Its IUPAC name is methyl N-[(4-hydroxy-3-methoxyphenyl)methylideneamino]carbamodithioate.
| Compound Name | methyl N-[(4-hydroxy-3-methoxyphenyl)methylideneamino]carbamodithioate |
|---|---|
| PubChem CID | 163408586 |
| Molecular Formula | C10H12N2O2S2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | methyl N-[(4-hydroxy-3-methoxyphenyl)methylideneamino]carbamodithioate |
| SMILES | COc1cc(C=NNC(=S)SC)ccc1O |
| InChI | InChI=1S/C10H12N2O2S2/c1-14-9-5-7(3-4-8(9)13)6-11-12-10(15)16-2/h3-6,13H,1-2H3,(H,12,15) |
| InChIKey | XQWLSVSGSJZKRO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|