C9H11N3O2S — CID 137207506
methyl N'-[(2,5-dihydroxyphenyl)methylideneamino]carbamimidothioate (PubChem CID 137207506) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is methyl N'-[(2,5-dihydroxyphenyl)methylideneamino]carbamimidothioate.
| Compound Name | methyl N'-[(2,5-dihydroxyphenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 137207506 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | methyl N'-[(2,5-dihydroxyphenyl)methylideneamino]carbamimidothioate |
| SMILES | CS/C(N)=N\N=Cc1cc(O)ccc1O |
| InChI | InChI=1S/C9H11N3O2S/c1-15-9(10)12-11-5-6-4-7(13)2-3-8(6)14/h2-5,13-14H,1H3,(H2,10,12) |
| InChIKey | MMEXHKVOXVAANC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|