C13H13IN3OS- — CID 135777394
methyl N'-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]carbamimidothioate iodide (PubChem CID 135777394) has the molecular formula C13H13IN3OS- and a molecular weight of 386.24 g/mol. Its IUPAC name is methyl N'-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]carbamimidothioate iodide.
| Compound Name | methyl N'-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]carbamimidothioate iodide |
|---|---|
| PubChem CID | 135777394 |
| Molecular Formula | C13H13IN3OS- |
| Molecular Weight | 386.24 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | methyl N'-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]carbamimidothioate iodide |
| SMILES | CS/C(N)=N/N=C/c1c(O)ccc2ccccc12.[I-] |
| InChI | InChI=1S/C13H13N3OS.HI/c1-18-13(14)16-15-8-11-10-5-3-2-4-9(10)6-7-12(11)17;/h2-8,17H,1H3,(H2,14,16);1H/p-1/b15-8+; |
| InChIKey | WFIYZQUFADEKIF-TWNLEINFSA-M |
| XLogP | -0.44 |
| TPSA | 70.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.24 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|