C28H28N2O2 — CID 136675821
1-[[3-[(2-hydroxynaphthalen-1-yl)methylideneamino]-2,3-dimethylbutan-2-yl]iminomethyl]naphthalen-2-ol (PubChem CID 136675821) has the molecular formula C28H28N2O2 and a molecular weight of 424.54 g/mol. Its IUPAC name is 1-[[3-[(2-hydroxynaphthalen-1-yl)methylideneamino]-2,3-dimethylbutan-2-yl]iminomethyl]naphthalen-2-ol.
| Compound Name | 1-[[3-[(2-hydroxynaphthalen-1-yl)methylideneamino]-2,3-dimethylbutan-2-yl]iminomethyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 136675821 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 1-[[3-[(2-hydroxynaphthalen-1-yl)methylideneamino]-2,3-dimethylbutan-2-yl]iminomethyl]naphthalen-2-ol |
| SMILES | CC(C)(/N=C/c1c(O)ccc2ccccc12)C(C)(C)/N=C/c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C28H28N2O2/c1-27(2,29-17-23-21-11-7-5-9-19(21)13-15-25(23)31)28(3,4)30-18-24-22-12-8-6-10-20(22)14-16-26(24)32/h5-18,31-32H,1-4H3/b29-17+,30-18+ |
| InChIKey | KBMIPMXYRWLYFI-YAGSLNJISA-N |
| XLogP | 6.50 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|