C17H19NO3 — CID 135445295
(2S)-2-[(2-hydroxynaphthalen-1-yl)methylideneamino]-3,3-dimethylbutanoic acid (PubChem CID 135445295) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is (2S)-2-[(2-hydroxynaphthalen-1-yl)methylideneamino]-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-[(2-hydroxynaphthalen-1-yl)methylideneamino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 135445295 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | (2S)-2-[(2-hydroxynaphthalen-1-yl)methylideneamino]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@H](/N=C/c1c(O)ccc2ccccc12)C(=O)O |
| InChI | InChI=1S/C17H19NO3/c1-17(2,3)15(16(20)21)18-10-13-12-7-5-4-6-11(12)8-9-14(13)19/h4-10,15,19H,1-3H3,(H,20,21)/b18-10+/t15-/m1/s1 |
| InChIKey | RBNVIUOPKBQXOO-BFERYNQYSA-N |
| XLogP | 3.46 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|