C15H17NO6V — CID 135497072
(2S)-3-hydroxy-2-[(2-hydroxynaphthalen-1-yl)methylideneamino]propanoic acid;methanol;oxovanadium (PubChem CID 135497072) has the molecular formula C15H17NO6V and a molecular weight of 358.25 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-[(2-hydroxynaphthalen-1-yl)methylideneamino]propanoic acid;methanol;oxovanadium.
| Compound Name | (2S)-3-hydroxy-2-[(2-hydroxynaphthalen-1-yl)methylideneamino]propanoic acid;methanol;oxovanadium |
|---|---|
| PubChem CID | 135497072 |
| Molecular Formula | C15H17NO6V |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | (2S)-3-hydroxy-2-[(2-hydroxynaphthalen-1-yl)methylideneamino]propanoic acid;methanol;oxovanadium |
| SMILES | CO.O=C(O)[C@H](CO)/N=C\c1c(O)ccc2ccccc12.O=[V] |
| InChI | InChI=1S/C14H13NO4.CH4O.O.V/c16-8-12(14(18)19)15-7-11-10-4-2-1-3-9(10)5-6-13(11)17;1-2;;/h1-7,12,16-17H,8H2,(H,18,19);2H,1H3;;/b15-7-;;;/t12-;;;/m0.../s1 |
| InChIKey | SRXWQGSPCKDUOK-MALAKLPGSA-N |
| XLogP | 0.90 |
| TPSA | 127.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|