C23H30N2O2 — CID 135516858
(2S)-N-cyclohexyl-2-[(2-hydroxynaphthalen-1-yl)methylideneamino]-4-methylpentanamide (PubChem CID 135516858) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-[(2-hydroxynaphthalen-1-yl)methylideneamino]-4-methylpentanamide.
| Compound Name | (2S)-N-cyclohexyl-2-[(2-hydroxynaphthalen-1-yl)methylideneamino]-4-methylpentanamide |
|---|---|
| PubChem CID | 135516858 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | (2S)-N-cyclohexyl-2-[(2-hydroxynaphthalen-1-yl)methylideneamino]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](/N=C/c1c(O)ccc2ccccc12)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C23H30N2O2/c1-16(2)14-21(23(27)25-18-9-4-3-5-10-18)24-15-20-19-11-7-6-8-17(19)12-13-22(20)26/h6-8,11-13,15-16,18,21,26H,3-5,9-10,14H2,1-2H3,(H,25,27)/b24-15+/t21-/m0/s1 |
| InChIKey | KKGNYRFJGBQDKX-SGSZHJQISA-N |
| XLogP | 4.83 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|