C36H28N2O2 — CID 3576819
1-[[2-[(2-hydroxynaphthalen-1-yl)methylideneamino]-1,2-diphenylethyl]iminomethyl]naphthalen-2-ol (PubChem CID 3576819) has the molecular formula C36H28N2O2 and a molecular weight of 520.63 g/mol. Its IUPAC name is 1-[[2-[(2-hydroxynaphthalen-1-yl)methylideneamino]-1,2-diphenylethyl]iminomethyl]naphthalen-2-ol.
| Compound Name | 1-[[2-[(2-hydroxynaphthalen-1-yl)methylideneamino]-1,2-diphenylethyl]iminomethyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 3576819 |
| Molecular Formula | C36H28N2O2 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | 1-[[2-[(2-hydroxynaphthalen-1-yl)methylideneamino]-1,2-diphenylethyl]iminomethyl]naphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1/C=N/C(c1ccccc1)C(/N=C/c1c(O)ccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C36H28N2O2/c39-33-21-19-25-11-7-9-17-29(25)31(33)23-37-35(27-13-3-1-4-14-27)36(28-15-5-2-6-16-28)38-24-32-30-18-10-8-12-26(30)20-22-34(32)40/h1-24,35-36,39-40H/b37-23+,38-24+ |
| InChIKey | XZHFWJJEJMNIAF-DNJOOXRZSA-N |
| XLogP | 8.42 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|