C34H38N2O9V2 — CID 135499712
bis((2S,3S)-2-[(2-hydroxynaphthalen-1-yl)methylideneamino]-3-methylpentanoic acid);oxo(oxovanadiooxy)vanadium (PubChem CID 135499712) has the molecular formula C34H38N2O9V2 and a molecular weight of 720.57 g/mol. Its IUPAC name is bis((2S,3S)-2-[(2-hydroxynaphthalen-1-yl)methylideneamino]-3-methylpentanoic acid);oxo(oxovanadiooxy)vanadium.
| Compound Name | bis((2S,3S)-2-[(2-hydroxynaphthalen-1-yl)methylideneamino]-3-methylpentanoic acid);oxo(oxovanadiooxy)vanadium |
|---|---|
| PubChem CID | 135499712 |
| Molecular Formula | C34H38N2O9V2 |
| Molecular Weight | 720.57 g/mol |
| Exact Mass | 720.15 |
| IUPAC Name | bis((2S,3S)-2-[(2-hydroxynaphthalen-1-yl)methylideneamino]-3-methylpentanoic acid);oxo(oxovanadiooxy)vanadium |
| SMILES | CC[C@H](C)[C@H](/N=C\c1c(O)ccc2ccccc12)C(=O)O.CC[C@H](C)[C@H](/N=C\c1c(O)ccc2ccccc12)C(=O)O.O=[V]O[V]=O |
| InChI | InChI=1S/2C17H19NO3.3O.2V/c2*1-3-11(2)16(17(20)21)18-10-14-13-7-5-4-6-12(13)8-9-15(14)19;;;;;/h2*4-11,16,19H,3H2,1-2H3,(H,20,21);;;;;/b2*18-10-;;;;;/t2*11-,16-;;;;;/m00...../s1 |
| InChIKey | SDQBNBHYGAHPRM-OZYGMOIESA-N |
| XLogP | 6.62 |
| TPSA | 183.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.57 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|