C25H18N2O2 — CID 136907701
(2E)-2-[(Z)-(2-hydroxynaphthalen-1-yl)methylidenehydrazinylidene]-1,2-diphenylethanone (PubChem CID 136907701) has the molecular formula C25H18N2O2 and a molecular weight of 378.43 g/mol. Its IUPAC name is (2E)-2-[(Z)-(2-hydroxynaphthalen-1-yl)methylidenehydrazinylidene]-1,2-diphenylethanone.
| Compound Name | (2E)-2-[(Z)-(2-hydroxynaphthalen-1-yl)methylidenehydrazinylidene]-1,2-diphenylethanone |
|---|---|
| PubChem CID | 136907701 |
| Molecular Formula | C25H18N2O2 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | (2E)-2-[(Z)-(2-hydroxynaphthalen-1-yl)methylidenehydrazinylidene]-1,2-diphenylethanone |
| SMILES | O=C(/C(=N/N=C\c1c(O)ccc2ccccc12)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H18N2O2/c28-23-16-15-18-9-7-8-14-21(18)22(23)17-26-27-24(19-10-3-1-4-11-19)25(29)20-12-5-2-6-13-20/h1-17,28H/b26-17-,27-24+ |
| InChIKey | HDARXOBQELQFES-YWSZXEFUSA-N |
| XLogP | 5.25 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|