C31H25N3O5V — CID 170896537
(NE,Z)-N-[(2-hydroxynaphthalen-1-yl)methylidene]benzenecarbohydrazonic acid;N-hydroxy-N-phenylbenzamide;oxovanadium (PubChem CID 170896537) has the molecular formula C31H25N3O5V and a molecular weight of 570.50 g/mol. Its IUPAC name is (NE,Z)-N-[(2-hydroxynaphthalen-1-yl)methylidene]benzenecarbohydrazonic acid;N-hydroxy-N-phenylbenzamide;oxovanadium.
| Compound Name | (NE,Z)-N-[(2-hydroxynaphthalen-1-yl)methylidene]benzenecarbohydrazonic acid;N-hydroxy-N-phenylbenzamide;oxovanadium |
|---|---|
| PubChem CID | 170896537 |
| Molecular Formula | C31H25N3O5V |
| Molecular Weight | 570.50 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | (NE,Z)-N-[(2-hydroxynaphthalen-1-yl)methylidene]benzenecarbohydrazonic acid;N-hydroxy-N-phenylbenzamide;oxovanadium |
| SMILES | O/C(=N\N=C/c1c(O)ccc2ccccc12)c1ccccc1.O=C(c1ccccc1)N(O)c1ccccc1.O=[V] |
| InChI | InChI=1S/C18H14N2O2.C13H11NO2.O.V/c21-17-11-10-13-6-4-5-9-15(13)16(17)12-19-20-18(22)14-7-2-1-3-8-14;15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;;/h1-12,21H,(H,20,22);1-10,16H;;/b19-12-;;; |
| InChIKey | MEILOJASNUASQX-AOEYRECCSA-N |
| XLogP | 6.49 |
| TPSA | 122.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.50 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|