C23H17N3O — CID 135583243
(2Z)-2-[(E)-1H-indol-3-ylmethylidenehydrazinylidene]-1,2-diphenylethanone (PubChem CID 135583243) has the molecular formula C23H17N3O and a molecular weight of 351.41 g/mol. Its IUPAC name is (2Z)-2-[(E)-1H-indol-3-ylmethylidenehydrazinylidene]-1,2-diphenylethanone.
| Compound Name | (2Z)-2-[(E)-1H-indol-3-ylmethylidenehydrazinylidene]-1,2-diphenylethanone |
|---|---|
| PubChem CID | 135583243 |
| Molecular Formula | C23H17N3O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | (2Z)-2-[(E)-1H-indol-3-ylmethylidenehydrazinylidene]-1,2-diphenylethanone |
| SMILES | O=C(/C(=N\N=C\c1c[nH]c2ccccc12)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H17N3O/c27-23(18-11-5-2-6-12-18)22(17-9-3-1-4-10-17)26-25-16-19-15-24-21-14-8-7-13-20(19)21/h1-16,24H/b25-16+,26-22- |
| InChIKey | FWEWNYXCCZYPAE-DDUHHROPSA-N |
| XLogP | 4.87 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|