C19H17N7 — CID 136742284
1,2-bis[(Z)-1H-indol-3-ylmethylideneamino]guanidine (PubChem CID 136742284) has the molecular formula C19H17N7 and a molecular weight of 343.39 g/mol. Its IUPAC name is 1,2-bis[(Z)-1H-indol-3-ylmethylideneamino]guanidine.
| Compound Name | 1,2-bis[(Z)-1H-indol-3-ylmethylideneamino]guanidine |
|---|---|
| PubChem CID | 136742284 |
| Molecular Formula | C19H17N7 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 1,2-bis[(Z)-1H-indol-3-ylmethylideneamino]guanidine |
| SMILES | NC(=N/N=C\c1c[nH]c2ccccc12)N/N=C\c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H17N7/c20-19(25-23-11-13-9-21-17-7-3-1-5-15(13)17)26-24-12-14-10-22-18-8-4-2-6-16(14)18/h1-12,21-22H,(H3,20,25,26)/b23-11-,24-12- |
| InChIKey | LZMTXKHRUZFEKI-CBSQCECLSA-N |
| XLogP | 2.92 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|