C21H21N7O2 — CID 135438347
1,2-bis[(E)-(5-methoxy-1H-indol-3-yl)methylideneamino]guanidine (PubChem CID 135438347) has the molecular formula C21H21N7O2 and a molecular weight of 403.45 g/mol. Its IUPAC name is 1,2-bis[(E)-(5-methoxy-1H-indol-3-yl)methylideneamino]guanidine.
| Compound Name | 1,2-bis[(E)-(5-methoxy-1H-indol-3-yl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 135438347 |
| Molecular Formula | C21H21N7O2 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 1,2-bis[(E)-(5-methoxy-1H-indol-3-yl)methylideneamino]guanidine |
| SMILES | COc1ccc2[nH]cc(/C=N/N=C(/N)N/N=C/c3c[nH]c4ccc(OC)cc34)c2c1 |
| InChI | InChI=1S/C21H21N7O2/c1-29-15-3-5-19-17(7-15)13(9-23-19)11-25-27-21(22)28-26-12-14-10-24-20-6-4-16(30-2)8-18(14)20/h3-12,23-24H,1-2H3,(H3,22,27,28)/b25-11+,26-12+ |
| InChIKey | MRLQYEDPOZZQRS-KOZSXFMUSA-N |
| XLogP | 2.94 |
| TPSA | 125.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|