C23H35N5O5 — CID 135870813
heptanedioic acid;1-[(Z)-(5-methoxy-1H-indol-3-yl)methylideneamino]-2-pentylguanidine (PubChem CID 135870813) has the molecular formula C23H35N5O5 and a molecular weight of 461.56 g/mol. Its IUPAC name is heptanedioic acid;1-[(Z)-(5-methoxy-1H-indol-3-yl)methylideneamino]-2-pentylguanidine.
| Compound Name | heptanedioic acid;1-[(Z)-(5-methoxy-1H-indol-3-yl)methylideneamino]-2-pentylguanidine |
|---|---|
| PubChem CID | 135870813 |
| Molecular Formula | C23H35N5O5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | heptanedioic acid;1-[(Z)-(5-methoxy-1H-indol-3-yl)methylideneamino]-2-pentylguanidine |
| SMILES | CCCCC/N=C(\N)N/N=C\c1c[nH]c2ccc(OC)cc12.O=C(O)CCCCCC(=O)O |
| InChI | InChI=1S/C16H23N5O.C7H12O4/c1-3-4-5-8-18-16(17)21-20-11-12-10-19-15-7-6-13(22-2)9-14(12)15;8-6(9)4-2-1-3-5-7(10)11/h6-7,9-11,19H,3-5,8H2,1-2H3,(H3,17,18,21);1-5H2,(H,8,9)(H,10,11)/b20-11-; |
| InChIKey | HAJQVAZGKKFONC-FZLYBSHOSA-N |
| XLogP | 3.71 |
| TPSA | 162.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|