C22H33N5O9 — CID 135922973
2-hydroxypropane-1,2,3-tricarboxylic acid;1-[(Z)-(5-methoxy-1H-indol-3-yl)methylideneamino]-2-pentylguanidine;hydrate (PubChem CID 135922973) has the molecular formula C22H33N5O9 and a molecular weight of 511.53 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;1-[(Z)-(5-methoxy-1H-indol-3-yl)methylideneamino]-2-pentylguanidine;hydrate.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;1-[(Z)-(5-methoxy-1H-indol-3-yl)methylideneamino]-2-pentylguanidine;hydrate |
|---|---|
| PubChem CID | 135922973 |
| Molecular Formula | C22H33N5O9 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;1-[(Z)-(5-methoxy-1H-indol-3-yl)methylideneamino]-2-pentylguanidine;hydrate |
| SMILES | CCCCC/N=C(\N)N/N=C\c1c[nH]c2ccc(OC)cc12.O.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H23N5O.C6H8O7.H2O/c1-3-4-5-8-18-16(17)21-20-11-12-10-19-15-7-6-13(22-2)9-14(12)15;7-3(8)1-6(13,5(11)12)2-4(9)10;/h6-7,9-11,19H,3-5,8H2,1-2H3,(H3,17,18,21);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1H2/b20-11-;; |
| InChIKey | XULFFIHXVAZKGE-ARFXNZMASA-N |
| XLogP | 0.53 |
| TPSA | 251.42 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|