C22H35N5O8 — CID 135922864
1-[(Z)-(5-methoxy-1H-indol-3-yl)methylideneamino]-2-pentylguanidine;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid (PubChem CID 135922864) has the molecular formula C22H35N5O8 and a molecular weight of 497.55 g/mol. Its IUPAC name is 1-[(Z)-(5-methoxy-1H-indol-3-yl)methylideneamino]-2-pentylguanidine;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid.
| Compound Name | 1-[(Z)-(5-methoxy-1H-indol-3-yl)methylideneamino]-2-pentylguanidine;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid |
|---|---|
| PubChem CID | 135922864 |
| Molecular Formula | C22H35N5O8 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | 1-[(Z)-(5-methoxy-1H-indol-3-yl)methylideneamino]-2-pentylguanidine;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid |
| SMILES | CCCCC/N=C(\N)N/N=C\c1c[nH]c2ccc(OC)cc12.O=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C16H23N5O.C6H12O7/c1-3-4-5-8-18-16(17)21-20-11-12-10-19-15-7-6-13(22-2)9-14(12)15;7-1-2(8)3(9)4(10)5(11)6(12)13/h6-7,9-11,19H,3-5,8H2,1-2H3,(H3,17,18,21);2-5,7-11H,1H2,(H,12,13)/b20-11-;/t;2-,3-,4+,5-/m.1/s1 |
| InChIKey | RTBUDYJIDTYZBN-IRBIEHTISA-N |
| XLogP | -0.89 |
| TPSA | 226.24 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|