C18H27N5O — CID 142998044
1-[(E)-(5-ethyl-1H-indol-3-yl)methylideneamino]-2-pentylguanidine;formaldehyde (PubChem CID 142998044) has the molecular formula C18H27N5O and a molecular weight of 329.45 g/mol. Its IUPAC name is 1-[(E)-(5-ethyl-1H-indol-3-yl)methylideneamino]-2-pentylguanidine;formaldehyde.
| Compound Name | 1-[(E)-(5-ethyl-1H-indol-3-yl)methylideneamino]-2-pentylguanidine;formaldehyde |
|---|---|
| PubChem CID | 142998044 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | 1-[(E)-(5-ethyl-1H-indol-3-yl)methylideneamino]-2-pentylguanidine;formaldehyde |
| SMILES | C=O.CCCCC/N=C(\N)N/N=C/c1c[nH]c2ccc(CC)cc12 |
| InChI | InChI=1S/C17H25N5.CH2O/c1-3-5-6-9-19-17(18)22-21-12-14-11-20-16-8-7-13(4-2)10-15(14)16;1-2/h7-8,10-12,20H,3-6,9H2,1-2H3,(H3,18,19,22);1H2/b21-12+; |
| InChIKey | UVTQGZZGNWXRMX-BFVDCFMLSA-N |
| XLogP | 2.97 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|