C19H21N5O — CID 135465941
1-[(E)-(5-hydroxy-1H-indol-3-yl)methylideneamino]-2-(3-phenylpropyl)guanidine (PubChem CID 135465941) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is 1-[(E)-(5-hydroxy-1H-indol-3-yl)methylideneamino]-2-(3-phenylpropyl)guanidine.
| Compound Name | 1-[(E)-(5-hydroxy-1H-indol-3-yl)methylideneamino]-2-(3-phenylpropyl)guanidine |
|---|---|
| PubChem CID | 135465941 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 1-[(E)-(5-hydroxy-1H-indol-3-yl)methylideneamino]-2-(3-phenylpropyl)guanidine |
| SMILES | N/C(=N\CCCc1ccccc1)N/N=C/c1c[nH]c2ccc(O)cc12 |
| InChI | InChI=1S/C19H21N5O/c20-19(21-10-4-7-14-5-2-1-3-6-14)24-23-13-15-12-22-18-9-8-16(25)11-17(15)18/h1-3,5-6,8-9,11-13,22,25H,4,7,10H2,(H3,20,21,24)/b23-13+ |
| InChIKey | JKUGOLBAIWHFRT-YDZHTSKRSA-N |
| XLogP | 2.74 |
| TPSA | 98.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|