C16H24IN5O — CID 135616888
1-[(Z)-(5-methoxy-1H-indol-3-yl)methylideneamino]-2-pentylguanidine;hydroiodide (PubChem CID 135616888) has the molecular formula C16H24IN5O and a molecular weight of 429.31 g/mol. Its IUPAC name is 1-[(Z)-(5-methoxy-1H-indol-3-yl)methylideneamino]-2-pentylguanidine;hydroiodide.
| Compound Name | 1-[(Z)-(5-methoxy-1H-indol-3-yl)methylideneamino]-2-pentylguanidine;hydroiodide |
|---|---|
| PubChem CID | 135616888 |
| Molecular Formula | C16H24IN5O |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 1-[(Z)-(5-methoxy-1H-indol-3-yl)methylideneamino]-2-pentylguanidine;hydroiodide |
| SMILES | CCCCC/N=C(\N)N/N=C\c1c[nH]c2ccc(OC)cc12.I |
| InChI | InChI=1S/C16H23N5O.HI/c1-3-4-5-8-18-16(17)21-20-11-12-10-19-15-7-6-13(22-2)9-14(12)15;/h6-7,9-11,19H,3-5,8H2,1-2H3,(H3,17,18,21);1H/b20-11-; |
| InChIKey | AORPQIVHOGZKAT-FZLYBSHOSA-N |
| XLogP | 3.22 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|