C22H31N5O8 — CID 135922861
2-hydroxypropane-1,2,3-tricarboxylic acid;1-[(E)-(5-methoxy-1H-indol-3-yl)methylideneamino]-2-pentylguanidine (PubChem CID 135922861) has the molecular formula C22H31N5O8 and a molecular weight of 493.52 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;1-[(E)-(5-methoxy-1H-indol-3-yl)methylideneamino]-2-pentylguanidine.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;1-[(E)-(5-methoxy-1H-indol-3-yl)methylideneamino]-2-pentylguanidine |
|---|---|
| PubChem CID | 135922861 |
| Molecular Formula | C22H31N5O8 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;1-[(E)-(5-methoxy-1H-indol-3-yl)methylideneamino]-2-pentylguanidine |
| SMILES | CCCCC/N=C(\N)N/N=C/c1c[nH]c2ccc(OC)cc12.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H23N5O.C6H8O7/c1-3-4-5-8-18-16(17)21-20-11-12-10-19-15-7-6-13(22-2)9-14(12)15;7-3(8)1-6(13,5(11)12)2-4(9)10/h6-7,9-11,19H,3-5,8H2,1-2H3,(H3,17,18,21);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/b20-11+; |
| InChIKey | RCDKBPORCFMLIC-DOELHFPHSA-N |
| XLogP | 1.36 |
| TPSA | 219.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|