C18H22Cl3N5O3 — CID 136622156
2,2,2-trichloroethyl 5-[[amino-[2-[(5-methoxy-1H-indol-3-yl)methylidene]hydrazinyl]methylidene]amino]pentanoate (PubChem CID 136622156) has the molecular formula C18H22Cl3N5O3 and a molecular weight of 462.77 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 5-[[amino-[2-[(5-methoxy-1H-indol-3-yl)methylidene]hydrazinyl]methylidene]amino]pentanoate.
| Compound Name | 2,2,2-trichloroethyl 5-[[amino-[2-[(5-methoxy-1H-indol-3-yl)methylidene]hydrazinyl]methylidene]amino]pentanoate |
|---|---|
| PubChem CID | 136622156 |
| Molecular Formula | C18H22Cl3N5O3 |
| Molecular Weight | 462.77 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 2,2,2-trichloroethyl 5-[[amino-[2-[(5-methoxy-1H-indol-3-yl)methylidene]hydrazinyl]methylidene]amino]pentanoate |
| SMILES | COc1ccc2[nH]cc(C=NN/C(N)=N/CCCCC(=O)OCC(Cl)(Cl)Cl)c2c1 |
| InChI | InChI=1S/C18H22Cl3N5O3/c1-28-13-5-6-15-14(8-13)12(9-24-15)10-25-26-17(22)23-7-3-2-4-16(27)29-11-18(19,20)21/h5-6,8-10,24H,2-4,7,11H2,1H3,(H3,22,23,26) |
| InChIKey | XNLGAXVARUCMAK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.77 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|