C33H40N10O2 — CID 135462953
1-[(Z)-(5-hydroxy-1H-indol-3-yl)methylideneamino]-2-pentylguanidine;1-[(Z)-(5-hydroxy-1H-indol-3-yl)methylideneamino]-2-(2-phenylethyl)guanidine (PubChem CID 135462953) has the molecular formula C33H40N10O2 and a molecular weight of 608.75 g/mol. Its IUPAC name is 1-[(Z)-(5-hydroxy-1H-indol-3-yl)methylideneamino]-2-pentylguanidine;1-[(Z)-(5-hydroxy-1H-indol-3-yl)methylideneamino]-2-(2-phenylethyl)guanidine.
| Compound Name | 1-[(Z)-(5-hydroxy-1H-indol-3-yl)methylideneamino]-2-pentylguanidine;1-[(Z)-(5-hydroxy-1H-indol-3-yl)methylideneamino]-2-(2-phenylethyl)guanidine |
|---|---|
| PubChem CID | 135462953 |
| Molecular Formula | C33H40N10O2 |
| Molecular Weight | 608.75 g/mol |
| Exact Mass | 608.33 |
| IUPAC Name | 1-[(Z)-(5-hydroxy-1H-indol-3-yl)methylideneamino]-2-pentylguanidine;1-[(Z)-(5-hydroxy-1H-indol-3-yl)methylideneamino]-2-(2-phenylethyl)guanidine |
| SMILES | CCCCC/N=C(\N)N/N=C\c1c[nH]c2ccc(O)cc12.N/C(=N\CCc1ccccc1)N/N=C\c1c[nH]c2ccc(O)cc12 |
| InChI | InChI=1S/C18H19N5O.C15H21N5O/c19-18(20-9-8-13-4-2-1-3-5-13)23-22-12-14-11-21-17-7-6-15(24)10-16(14)17;1-2-3-4-7-17-15(16)20-19-10-11-9-18-14-6-5-12(21)8-13(11)14/h1-7,10-12,21,24H,8-9H2,(H3,19,20,23);5-6,8-10,18,21H,2-4,7H2,1H3,(H3,16,17,20)/b22-12-;19-10- |
| InChIKey | KZMKEBQUNYRQKR-WPXIMCNSSA-N |
| XLogP | 4.66 |
| TPSA | 197.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.75 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|