C19H18ClN7 — CID 135915344
1,2-bis[(Z)-1H-indol-3-ylmethylideneamino]guanidine;hydrochloride (PubChem CID 135915344) has the molecular formula C19H18ClN7 and a molecular weight of 379.86 g/mol. Its IUPAC name is 1,2-bis[(Z)-1H-indol-3-ylmethylideneamino]guanidine;hydrochloride.
| Compound Name | 1,2-bis[(Z)-1H-indol-3-ylmethylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 135915344 |
| Molecular Formula | C19H18ClN7 |
| Molecular Weight | 379.86 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 1,2-bis[(Z)-1H-indol-3-ylmethylideneamino]guanidine;hydrochloride |
| SMILES | Cl.N/C(=N/N=C\c1c[nH]c2ccccc12)N/N=C\c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H17N7.ClH/c20-19(25-23-11-13-9-21-17-7-3-1-5-15(13)17)26-24-12-14-10-22-18-8-4-2-6-16(14)18;/h1-12,21-22H,(H3,20,25,26);1H/b23-11-,24-12-; |
| InChIKey | CMYYQVAAQVXGSR-YVYRESBNSA-N |
| XLogP | 3.34 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.86 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|