C10H12N6O2 — CID 3913229
1-(dihydroxyamino)-2-(1H-indol-3-ylmethylideneamino)guanidine (PubChem CID 3913229) has the molecular formula C10H12N6O2 and a molecular weight of 248.25 g/mol. Its IUPAC name is 1-(dihydroxyamino)-2-(1H-indol-3-ylmethylideneamino)guanidine.
| Compound Name | 1-(dihydroxyamino)-2-(1H-indol-3-ylmethylideneamino)guanidine |
|---|---|
| PubChem CID | 3913229 |
| Molecular Formula | C10H12N6O2 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1-(dihydroxyamino)-2-(1H-indol-3-ylmethylideneamino)guanidine |
| SMILES | NC(=NN=Cc1c[nH]c2ccccc12)NN(O)O |
| InChI | InChI=1S/C10H12N6O2/c11-10(15-16(17)18)14-13-6-7-5-12-9-4-2-1-3-8(7)9/h1-6,12,17-18H,(H3,11,14,15) |
| InChIKey | QCNFVYYYORWRDB-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 122.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|