About methyl N'-[(E)-(2,6-dichlorophenyl)methylideneamino]carbamimidothioate
methyl N'-[(E)-(2,6-dichlorophenyl)methylideneamino]carbamimidothioate (PubChem CID 172916516) has the molecular formula C9H9Cl2N3S
and a molecular weight of 262.17 g/mol. Its IUPAC name is methyl N'-[(E)-(2,6-dichlorophenyl)methylideneamino]carbamimidothioate.
Molecular Properties
| Compound Name | methyl N'-[(E)-(2,6-dichlorophenyl)methylideneamino]carbamimidothioate |
| PubChem CID | 172916516 |
| Molecular Formula | C9H9Cl2N3S |
| Molecular Weight | 262.17 g/mol |
| Exact Mass | 260.99 |
| IUPAC Name | methyl N'-[(E)-(2,6-dichlorophenyl)methylideneamino]carbamimidothioate |
| SMILES | CSC(N)=N/N=C/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H9Cl2N3S/c1-15-9(12)14-13-5-6-7(10)3-2-4-8(6)11/h2-5H,1H3,(H2,12,14)/b13-5+ |
| InChIKey | JFACCSGVXISTHC-WLRTZDKTSA-N |
| XLogP | 3.01 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.17 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl N'-[(E)-(2,6-dichlorophenyl)methylideneamino]carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N'-[(E)-(2,6-dichlorophenyl)methylideneamino]carbamimidothioate?
The IUPAC name of methyl N'-[(E)-(2,6-dichlorophenyl)methylideneamino]carbamimidothioate (CID 172916516) is methyl N'-[(E)-(2,6-dichlorophenyl)methylideneamino]carbamimidothioate.
What is the SMILES notation for methyl N'-[(E)-(2,6-dichlorophenyl)methylideneamino]carbamimidothioate?
The canonical SMILES for methyl N'-[(E)-(2,6-dichlorophenyl)methylideneamino]carbamimidothioate is CSC(N)=N/N=C/c1c(Cl)cccc1Cl.
What is the InChIKey of methyl N'-[(E)-(2,6-dichlorophenyl)methylideneamino]carbamimidothioate?
The InChIKey is JFACCSGVXISTHC-WLRTZDKTSA-N. The full InChI is InChI=1S/C9H9Cl2N3S/c1-15-9(12)14-13-5-6-7(10)3-2-4-8(6)11/h2-5H,1H3,(H2,12,14)/b13-5+.
What are the key properties of methyl N'-[(E)-(2,6-dichlorophenyl)methylideneamino]carbamimidothioate?
methyl N'-[(E)-(2,6-dichlorophenyl)methylideneamino]carbamimidothioate has a molecular weight of 262.17 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N'-[(E)-(2,6-dichlorophenyl)methylideneamino]carbamimidothioate is sourced from PubChem (CID 172916516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).