C12H16Cl2N4O — CID 172918159
1-butoxy-2-[(E)-(2,6-dichlorophenyl)methylideneamino]guanidine (PubChem CID 172918159) has the molecular formula C12H16Cl2N4O and a molecular weight of 303.19 g/mol. Its IUPAC name is 1-butoxy-2-[(E)-(2,6-dichlorophenyl)methylideneamino]guanidine.
| Compound Name | 1-butoxy-2-[(E)-(2,6-dichlorophenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 172918159 |
| Molecular Formula | C12H16Cl2N4O |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 1-butoxy-2-[(E)-(2,6-dichlorophenyl)methylideneamino]guanidine |
| SMILES | CCCCONC(N)=N/N=C/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H16Cl2N4O/c1-2-3-7-19-18-12(15)17-16-8-9-10(13)5-4-6-11(9)14/h4-6,8H,2-3,7H2,1H3,(H3,15,17,18)/b16-8+ |
| InChIKey | AXJAXJGFSLXJGF-LZYBPNLTSA-N |
| XLogP | 2.96 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|