C12H18N4O — CID 110340446
2-[(E)-(3-butoxyphenyl)methylideneamino]guanidine (PubChem CID 110340446) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-[(E)-(3-butoxyphenyl)methylideneamino]guanidine.
| Compound Name | 2-[(E)-(3-butoxyphenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 110340446 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 2-[(E)-(3-butoxyphenyl)methylideneamino]guanidine |
| SMILES | CCCCOc1cccc(/C=N/N=C(N)N)c1 |
| InChI | InChI=1S/C12H18N4O/c1-2-3-7-17-11-6-4-5-10(8-11)9-15-16-12(13)14/h4-6,8-9H,2-3,7H2,1H3,(H4,13,14,16)/b15-9+ |
| InChIKey | BQPCPBHTPNBKPA-OQLLNIDSSA-N |
| XLogP | 1.47 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|