C10H14N4O — CID 76880079
2-[(3-ethoxyphenyl)methylideneamino]guanidine (PubChem CID 76880079) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-[(3-ethoxyphenyl)methylideneamino]guanidine.
| Compound Name | 2-[(3-ethoxyphenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 76880079 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-[(3-ethoxyphenyl)methylideneamino]guanidine |
| SMILES | CCOc1cccc(C=NN=C(N)N)c1 |
| InChI | InChI=1S/C10H14N4O/c1-2-15-9-5-3-4-8(6-9)7-13-14-10(11)12/h3-7H,2H2,1H3,(H4,11,12,14) |
| InChIKey | JBDZSGQCEUKJSW-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|