C12H16N4O3 — CID 71670101
ethyl 2-[3-[(Z)-(diaminomethylidenehydrazinylidene)methyl]phenoxy]acetate (PubChem CID 71670101) has the molecular formula C12H16N4O3 and a molecular weight of 264.29 g/mol. Its IUPAC name is ethyl 2-[3-[(Z)-(diaminomethylidenehydrazinylidene)methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[3-[(Z)-(diaminomethylidenehydrazinylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 71670101 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | ethyl 2-[3-[(Z)-(diaminomethylidenehydrazinylidene)methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cccc(/C=N\N=C(N)N)c1 |
| InChI | InChI=1S/C12H16N4O3/c1-2-18-11(17)8-19-10-5-3-4-9(6-10)7-15-16-12(13)14/h3-7H,2,8H2,1H3,(H4,13,14,16)/b15-7- |
| InChIKey | YQZPAOUJGFRJSF-CHHVJCJISA-N |
| XLogP | 0.24 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|