C12H15BrN4O3 — CID 168590773
ethyl 2-[4-bromo-2-[(diaminomethylidenehydrazinylidene)methyl]phenoxy]acetate (PubChem CID 168590773) has the molecular formula C12H15BrN4O3 and a molecular weight of 343.18 g/mol. Its IUPAC name is ethyl 2-[4-bromo-2-[(diaminomethylidenehydrazinylidene)methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-bromo-2-[(diaminomethylidenehydrazinylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 168590773 |
| Molecular Formula | C12H15BrN4O3 |
| Molecular Weight | 343.18 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | ethyl 2-[4-bromo-2-[(diaminomethylidenehydrazinylidene)methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(Br)cc1C=NN=C(N)N |
| InChI | InChI=1S/C12H15BrN4O3/c1-2-19-11(18)7-20-10-4-3-9(13)5-8(10)6-16-17-12(14)15/h3-6H,2,7H2,1H3,(H4,14,15,17) |
| InChIKey | UGDPKBKLSFHMRA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.18 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|