C12H15BrN4O3 — CID 168590749
2-[[5-bromo-2-(1,3-dioxolan-2-ylmethoxy)phenyl]methylideneamino]guanidine (PubChem CID 168590749) has the molecular formula C12H15BrN4O3 and a molecular weight of 343.18 g/mol. Its IUPAC name is 2-[[5-bromo-2-(1,3-dioxolan-2-ylmethoxy)phenyl]methylideneamino]guanidine.
| Compound Name | 2-[[5-bromo-2-(1,3-dioxolan-2-ylmethoxy)phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168590749 |
| Molecular Formula | C12H15BrN4O3 |
| Molecular Weight | 343.18 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 2-[[5-bromo-2-(1,3-dioxolan-2-ylmethoxy)phenyl]methylideneamino]guanidine |
| SMILES | NC(N)=NN=Cc1cc(Br)ccc1OCC1OCCO1 |
| InChI | InChI=1S/C12H15BrN4O3/c13-9-1-2-10(20-7-11-18-3-4-19-11)8(5-9)6-16-17-12(14)15/h1-2,5-6,11H,3-4,7H2,(H4,14,15,17) |
| InChIKey | BCMBRRVHFCGUFM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|