C11H11BrO4 — CID 75406688
4-bromo-2-(1,3-dioxolan-2-ylmethoxy)benzaldehyde (PubChem CID 75406688) has the molecular formula C11H11BrO4 and a molecular weight of 287.11 g/mol. Its IUPAC name is 4-bromo-2-(1,3-dioxolan-2-ylmethoxy)benzaldehyde.
| Compound Name | 4-bromo-2-(1,3-dioxolan-2-ylmethoxy)benzaldehyde |
|---|---|
| PubChem CID | 75406688 |
| Molecular Formula | C11H11BrO4 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 4-bromo-2-(1,3-dioxolan-2-ylmethoxy)benzaldehyde |
| SMILES | O=Cc1ccc(Br)cc1OCC1OCCO1 |
| InChI | InChI=1S/C11H11BrO4/c12-9-2-1-8(6-13)10(5-9)16-7-11-14-3-4-15-11/h1-2,5-6,11H,3-4,7H2 |
| InChIKey | SJVASKYRYLNQKL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|