C9H7BrF2O2 — CID 82006187
4-bromo-2-(2,2-difluoroethoxy)benzaldehyde (PubChem CID 82006187) has the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. Its IUPAC name is 4-bromo-2-(2,2-difluoroethoxy)benzaldehyde.
| Compound Name | 4-bromo-2-(2,2-difluoroethoxy)benzaldehyde |
|---|---|
| PubChem CID | 82006187 |
| Molecular Formula | C9H7BrF2O2 |
| Molecular Weight | 265.05 g/mol |
| Exact Mass | 263.96 |
| IUPAC Name | 4-bromo-2-(2,2-difluoroethoxy)benzaldehyde |
| SMILES | O=Cc1ccc(Br)cc1OCC(F)F |
| InChI | InChI=1S/C9H7BrF2O2/c10-7-2-1-6(4-13)8(3-7)14-5-9(11)12/h1-4,9H,5H2 |
| InChIKey | NVHOYFUTOPDPHK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.05 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|