About (5-bromo-2-formylphenyl) hypochlorite
(5-bromo-2-formylphenyl) hypochlorite (PubChem CID 22608477) has the molecular formula C7H4BrClO2
and a molecular weight of 235.46 g/mol. Its IUPAC name is (5-bromo-2-formylphenyl) hypochlorite.
Molecular Properties
| Compound Name | (5-bromo-2-formylphenyl) hypochlorite |
| PubChem CID | 22608477 |
| Molecular Formula | C7H4BrClO2 |
| Molecular Weight | 235.46 g/mol |
| Exact Mass | 233.91 |
| IUPAC Name | (5-bromo-2-formylphenyl) hypochlorite |
| SMILES | O=Cc1ccc(Br)cc1OCl |
| InChI | InChI=1S/C7H4BrClO2/c8-6-2-1-5(4-10)7(3-6)11-9/h1-4H |
| InChIKey | OKYWHYBPTQBZMG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (5-bromo-2-formylphenyl) hypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-2-formylphenyl) hypochlorite?
The IUPAC name of (5-bromo-2-formylphenyl) hypochlorite (CID 22608477) is (5-bromo-2-formylphenyl) hypochlorite.
What is the SMILES notation for (5-bromo-2-formylphenyl) hypochlorite?
The canonical SMILES for (5-bromo-2-formylphenyl) hypochlorite is O=Cc1ccc(Br)cc1OCl.
What is the InChIKey of (5-bromo-2-formylphenyl) hypochlorite?
The InChIKey is OKYWHYBPTQBZMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrClO2/c8-6-2-1-5(4-10)7(3-6)11-9/h1-4H.
What are the key properties of (5-bromo-2-formylphenyl) hypochlorite?
(5-bromo-2-formylphenyl) hypochlorite has a molecular weight of 235.46 g/mol, XLogP of 2.79, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-2-formylphenyl) hypochlorite is sourced from PubChem (CID 22608477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).