C10H7BrF2O — CID 162788176
4-bromo-1-(2,2-difluoroethoxy)-2-ethynylbenzene (PubChem CID 162788176) has the molecular formula C10H7BrF2O and a molecular weight of 261.06 g/mol. Its IUPAC name is 4-bromo-1-(2,2-difluoroethoxy)-2-ethynylbenzene.
| Compound Name | 4-bromo-1-(2,2-difluoroethoxy)-2-ethynylbenzene |
|---|---|
| PubChem CID | 162788176 |
| Molecular Formula | C10H7BrF2O |
| Molecular Weight | 261.06 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | 4-bromo-1-(2,2-difluoroethoxy)-2-ethynylbenzene |
| SMILES | C#Cc1cc(Br)ccc1OCC(F)F |
| InChI | InChI=1S/C10H7BrF2O/c1-2-7-5-8(11)3-4-9(7)14-6-10(12)13/h1,3-5,10H,6H2 |
| InChIKey | BWHUPQWWBDGKIP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.06 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|