C11H10F2O — CID 155928767
2-(2,2-difluoroethoxy)-1-ethynyl-4-methylbenzene (PubChem CID 155928767) has the molecular formula C11H10F2O and a molecular weight of 196.20 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-1-ethynyl-4-methylbenzene.
| Compound Name | 2-(2,2-difluoroethoxy)-1-ethynyl-4-methylbenzene |
|---|---|
| PubChem CID | 155928767 |
| Molecular Formula | C11H10F2O |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-1-ethynyl-4-methylbenzene |
| SMILES | C#Cc1ccc(C)cc1OCC(F)F |
| InChI | InChI=1S/C11H10F2O/c1-3-9-5-4-8(2)6-10(9)14-7-11(12)13/h1,4-6,11H,7H2,2H3 |
| InChIKey | YAEIYCQOYPETRS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|