C9H9F2N3O — CID 169325952
1-azido-2-(2,2-difluoroethoxy)-4-methylbenzene (PubChem CID 169325952) has the molecular formula C9H9F2N3O and a molecular weight of 213.19 g/mol. Its IUPAC name is 1-azido-2-(2,2-difluoroethoxy)-4-methylbenzene.
| Compound Name | 1-azido-2-(2,2-difluoroethoxy)-4-methylbenzene |
|---|---|
| PubChem CID | 169325952 |
| Molecular Formula | C9H9F2N3O |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 1-azido-2-(2,2-difluoroethoxy)-4-methylbenzene |
| SMILES | Cc1ccc(N=[N+]=[N-])c(OCC(F)F)c1 |
| InChI | InChI=1S/C9H9F2N3O/c1-6-2-3-7(13-14-12)8(4-6)15-5-9(10)11/h2-4,9H,5H2,1H3 |
| InChIKey | ITZGKNPDDVJQHZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|