C8H7BrF3NO — CID 82004312
5-bromo-2-(2,2-difluoroethoxy)-4-fluoroaniline (PubChem CID 82004312) has the molecular formula C8H7BrF3NO and a molecular weight of 270.05 g/mol. Its IUPAC name is 5-bromo-2-(2,2-difluoroethoxy)-4-fluoroaniline.
| Compound Name | 5-bromo-2-(2,2-difluoroethoxy)-4-fluoroaniline |
|---|---|
| PubChem CID | 82004312 |
| Molecular Formula | C8H7BrF3NO |
| Molecular Weight | 270.05 g/mol |
| Exact Mass | 268.97 |
| IUPAC Name | 5-bromo-2-(2,2-difluoroethoxy)-4-fluoroaniline |
| SMILES | Nc1cc(Br)c(F)cc1OCC(F)F |
| InChI | InChI=1S/C8H7BrF3NO/c9-4-1-6(13)7(2-5(4)10)14-3-8(11)12/h1-2,8H,3,13H2 |
| InChIKey | GFIUUECHXLXLQB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.05 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|