C8H6BrF3O — CID 83231769
2-bromo-4-(2,2-difluoroethoxy)-1-fluorobenzene (PubChem CID 83231769) has the molecular formula C8H6BrF3O and a molecular weight of 255.03 g/mol. Its IUPAC name is 2-bromo-4-(2,2-difluoroethoxy)-1-fluorobenzene.
| Compound Name | 2-bromo-4-(2,2-difluoroethoxy)-1-fluorobenzene |
|---|---|
| PubChem CID | 83231769 |
| Molecular Formula | C8H6BrF3O |
| Molecular Weight | 255.03 g/mol |
| Exact Mass | 253.96 |
| IUPAC Name | 2-bromo-4-(2,2-difluoroethoxy)-1-fluorobenzene |
| SMILES | Fc1ccc(OCC(F)F)cc1Br |
| InChI | InChI=1S/C8H6BrF3O/c9-6-3-5(1-2-7(6)10)13-4-8(11)12/h1-3,8H,4H2 |
| InChIKey | SDSOMGXMXQIYED-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.03 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |