C8H6BrF2NO3 — CID 155920723
2-bromo-4-(2,2-difluoroethoxy)-1-nitrobenzene (PubChem CID 155920723) has the molecular formula C8H6BrF2NO3 and a molecular weight of 282.04 g/mol. Its IUPAC name is 2-bromo-4-(2,2-difluoroethoxy)-1-nitrobenzene.
| Compound Name | 2-bromo-4-(2,2-difluoroethoxy)-1-nitrobenzene |
|---|---|
| PubChem CID | 155920723 |
| Molecular Formula | C8H6BrF2NO3 |
| Molecular Weight | 282.04 g/mol |
| Exact Mass | 280.95 |
| IUPAC Name | 2-bromo-4-(2,2-difluoroethoxy)-1-nitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(OCC(F)F)cc1Br |
| InChI | InChI=1S/C8H6BrF2NO3/c9-6-3-5(15-4-8(10)11)1-2-7(6)12(13)14/h1-3,8H,4H2 |
| InChIKey | ZQQTWSNVEDOHQK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.04 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|