C10H10F3NO5 — CID 69454112
3-[4-nitro-3-(trifluoromethyl)phenoxy]propane-1,2-diol (PubChem CID 69454112) has the molecular formula C10H10F3NO5 and a molecular weight of 281.19 g/mol. Its IUPAC name is 3-[4-nitro-3-(trifluoromethyl)phenoxy]propane-1,2-diol.
| Compound Name | 3-[4-nitro-3-(trifluoromethyl)phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 69454112 |
| Molecular Formula | C10H10F3NO5 |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 3-[4-nitro-3-(trifluoromethyl)phenoxy]propane-1,2-diol |
| SMILES | O=[N+]([O-])c1ccc(OCC(O)CO)cc1C(F)(F)F |
| InChI | InChI=1S/C10H10F3NO5/c11-10(12,13)8-3-7(19-5-6(16)4-15)1-2-9(8)14(17)18/h1-3,6,15-16H,4-5H2 |
| InChIKey | BVWUZYHOPKCTDW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|