C9H9N3O9 — CID 98526993
(2S)-3-(2,4,6-trinitrophenoxy)propane-1,2-diol (PubChem CID 98526993) has the molecular formula C9H9N3O9 and a molecular weight of 303.18 g/mol. Its IUPAC name is (2S)-3-(2,4,6-trinitrophenoxy)propane-1,2-diol.
| Compound Name | (2S)-3-(2,4,6-trinitrophenoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 98526993 |
| Molecular Formula | C9H9N3O9 |
| Molecular Weight | 303.18 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | (2S)-3-(2,4,6-trinitrophenoxy)propane-1,2-diol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(OC[C@@H](O)CO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H9N3O9/c13-3-6(14)4-21-9-7(11(17)18)1-5(10(15)16)2-8(9)12(19)20/h1-2,6,13-14H,3-4H2/t6-/m0/s1 |
| InChIKey | LEEUBRSBSFSCOR-LURJTMIESA-N |
| XLogP | 0.14 |
| TPSA | 179.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.18 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|