C9H9Cl2NO4 — CID 65278078
1-(2,6-dichloro-4-nitrophenoxy)propan-2-ol (PubChem CID 65278078) has the molecular formula C9H9Cl2NO4 and a molecular weight of 266.08 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-nitrophenoxy)propan-2-ol.
| Compound Name | 1-(2,6-dichloro-4-nitrophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 65278078 |
| Molecular Formula | C9H9Cl2NO4 |
| Molecular Weight | 266.08 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | 1-(2,6-dichloro-4-nitrophenoxy)propan-2-ol |
| SMILES | CC(O)COc1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C9H9Cl2NO4/c1-5(13)4-16-9-7(10)2-6(12(14)15)3-8(9)11/h2-3,5,13H,4H2,1H3 |
| InChIKey | BXRMPVOKCOTVGZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.08 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|