C13H18Cl2N2O4 — CID 115476077
1-(tert-butylamino)-3-(2,6-dichloro-4-nitrophenoxy)propan-2-ol (PubChem CID 115476077) has the molecular formula C13H18Cl2N2O4 and a molecular weight of 337.20 g/mol. Its IUPAC name is 1-(tert-butylamino)-3-(2,6-dichloro-4-nitrophenoxy)propan-2-ol.
| Compound Name | 1-(tert-butylamino)-3-(2,6-dichloro-4-nitrophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 115476077 |
| Molecular Formula | C13H18Cl2N2O4 |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 1-(tert-butylamino)-3-(2,6-dichloro-4-nitrophenoxy)propan-2-ol |
| SMILES | CC(C)(C)NCC(O)COc1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C13H18Cl2N2O4/c1-13(2,3)16-6-9(18)7-21-12-10(14)4-8(17(19)20)5-11(12)15/h4-5,9,16,18H,6-7H2,1-3H3 |
| InChIKey | RZQNPTTXQROPDC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|